![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | 1. Worksheet Bundle Pack/ | 2024-11-25 14:20 | - | |
| 2. TOEIC levels 120-545 A1, A2 Beginner English Grammar/ | 2024-11-25 14:30 | - | |
| 3. Nouns Common and Proper Nouns Beginner/ | 2024-11-25 14:34 | - | |
| 4. Pronouns Subject and Object Pronouns Beginner/ | 2024-11-25 14:40 | - | |
| 5. Articles A - An - The Beginner/ | 2024-11-25 14:43 | - | |
| 6. Demonstratives This - That - These - Those Beginner/ | 2024-11-25 14:47 | - | |
| 7. Distributives All - Half Beginner/ | 2024-11-25 14:51 | - | |
| 8. Distributives Each - Every Beginner/ | 2024-11-25 14:54 | - | |
| 9. Verb Conjugation - 1st person, 2nd person, 3rd person Beginner/ | 2024-11-25 14:56 | - | |
| 10. Verbs Simple Tense and Subject-Verb Agreement Beginner/ | 2024-11-25 14:22 | - | |
| 11. The Gerund - ing Beginner/ | 2024-11-25 14:23 | - | |
| 12. Helping Verbs (Auxillary Verbs) To Be Beginner/ | 2024-11-25 14:23 | - | |
| 13. Helping Verbs (Auxillary Verbs) To Do - To Have Beginner/ | 2024-11-25 14:23 | - | |
| 14. Modal Verbs Can - Could Beginner/ | 2024-11-25 14:24 | - | |
| 15. Adjectives and Adverbs Introduction Beginner/ | 2024-11-25 14:24 | - | |
| 16. Adjectives Descriptive Adjectives Beginner/ | 2024-11-25 14:25 | - | |
| 17. Adjectives Proper Adjectives Beginner/ | 2024-11-25 14:29 | - | |
| 18. Adjectives Possessive Adjectives Beginner/ | 2024-11-25 14:30 | - | |
| 19. Adverbs How to Form Adverbs Beginner/ | 2024-11-25 14:30 | - | |
| 20. Adverbs Adverbs of Manner Beginner/ | 2024-11-25 14:30 | - | |
| 21. Adverbs Adverbs of Place Beginner/ | 2024-11-25 14:31 | - | |
| 22. Adverbs Adverbs of Time Beginner/ | 2024-11-25 14:31 | - | |
| 23. Prepositions Introduction Beginner/ | 2024-11-25 14:32 | - | |
| 24. Prepositions Prepositions of Place Beginner/ | 2024-11-25 14:32 | - | |
| 25. Prepositions Prepositions of Time Beginner/ | 2024-11-25 14:32 | - | |
| 26. Prepositions Prepositions of Direction or Motion Beginner/ | 2024-11-25 14:33 | - | |
| 27. Conjunctions Introduction Beginner/ | 2024-11-25 14:33 | - | |
| 28. Conjunctions Coordinating Conjunctions Beginner/ | 2024-11-25 14:34 | - | |
| 29. TOEIC levels 225 - 940 A2, B1, B2 Intermediate English Grammar/ | 2024-11-25 14:34 | - | |
| 30. Nouns Material and Compound Nouns Intermediate/ | 2024-11-25 14:35 | - | |
| 31. Nouns Countable vs Uncountable Nouns Intermediate/ | 2024-11-25 14:36 | - | |
| 32. Nouns Collective Nouns Intermediate/ | 2024-11-25 14:36 | - | |
| 33. Nouns Concrete and Abstract Nouns Intermediate/ | 2024-11-25 14:36 | - | |
| 34. Possessive Nouns and Possessive Pronouns Intermediate/ | 2024-11-25 14:37 | - | |
| 35. Quantifiers A few - A little Intermediate/ | 2024-11-25 14:37 | - | |
| 36. Quantifiers Much - Many Intermediate/ | 2024-11-25 14:38 | - | |
| 37. Quantifiers A lot - Most Intermediate/ | 2024-11-25 14:38 | - | |
| 38. Quantifiers Some - Any - Enough Intermediate/ | 2024-11-25 14:38 | - | |
| 39. Distributuives Both, Either, Neither Intermediate/ | 2024-11-25 14:39 | - | |
| 40. Present Particple Intermediate/ | 2024-11-25 14:40 | - | |
| 41. Verbs Continuous Tense Intermediate/ | 2024-11-25 14:41 | - | |
| 42. Modal Verbs Must - May - Might Intermediate/ | 2024-11-25 14:41 | - | |
| 43. Modal Verbs Shall - Should Intermediate/ | 2024-11-25 14:41 | - | |
| 44. Modal Verbs Will - Would Intermediate/ | 2024-11-25 14:42 | - | |
| 45. Adjectives Limiting Adjectives Intermediate/ | 2024-11-25 14:42 | - | |
| 46. Adjectives Pronomial Adjectives Intermediate/ | 2024-11-25 14:42 | - | |
| 47. Adjectives Comparative Adjectives Intermediate/ | 2024-11-25 14:42 | - | |
| 48. Adjectives Superlative Adjectives Intermediate/ | 2024-11-25 14:43 | - | |
| 49. Adverbs Adverbs of Frequency Intermediate/ | 2024-11-25 14:43 | - | |
| 50. Adverbs Adverbs of Degree Intermediate/ | 2024-11-25 14:44 | - | |
| 51. Adverbs Comparative and Superlative Adverbs Intermediate/ | 2024-11-25 14:44 | - | |
| 52. Prepositions Prepositions of Manner Intermediate/ | 2024-11-25 14:44 | - | |
| 53. Prepositions Prepositions of Cause, Purpose, and Reason Intermediate/ | 2024-11-25 14:45 | - | |
| 54. Prepositions Prepositional Phrases Intermediate/ | 2024-11-25 14:45 | - | |
| 55. Conjunctions Subordinate Conjunctions Intermediate/ | 2024-11-25 14:45 | - | |
| 56. Conjunctions Correlative Conjunctions Intermediate/ | 2024-11-25 14:45 | - | |
| 57. Conjunctions Compound Conjunctions Intermediate/ | 2024-11-25 14:46 | - | |
| 58. TOEIC levels 785 - 990 B2, C1 Advanced English Grammar/ | 2024-11-25 14:46 | - | |
| 59. Verbs Present Perfect and Present Perfect Continuous Tense Advanced/ | 2024-11-25 14:46 | - | |
| 60. Verbs Past Perfect and Past Perfect Continuous Tense Advanced/ | 2024-11-25 14:47 | - | |
| 61. Verbs Future Perfect and Future Perfect Continuous Tense Advanced/ | 2024-11-25 14:48 | - | |
| 62. Past Particple Advanced/ | 2024-11-25 14:48 | - | |
| 63. Phrasal Verbs Give up - Turn Out Advanced/ | 2024-11-25 14:49 | - | |
| 64. Phrasal Verbs Carry On - Put Off Advanced/ | 2024-11-25 14:49 | - | |
| 65. Phrasal Verbs Turn Down - Break Up Advanced/ | 2024-11-25 14:49 | - | |
| 66. Pre-determiners Advanced/ | 2024-11-25 14:50 | - | |
| 67. Orders of Adverbs Advanced/ | 2024-11-25 14:50 | - | |
| 68. Pseudo Conjunctions Advanced/ | 2024-11-25 14:50 | - | |
| 69. Passive vs. Active Voice Advanced/ | 2024-11-25 14:50 | - | |
| 70. Conditionals Advanced/ | 2024-11-25 14:51 | - | |
| 71. Conditionals Zero Type Advanced/ | 2024-11-25 14:52 | - | |
| 72. Conditionals Type 1 Advanced/ | 2024-11-25 14:52 | - | |
| 73. Conditionals Type 2 Advanced/ | 2024-11-25 14:52 | - | |
| 74. Conditionals Type 3 Advanced/ | 2024-11-25 14:52 | - | |
| 75. Conditionals Mixed Type Advanced/ | 2024-11-25 14:53 | - | |
| 76. Sentence Clauses Advanced/ | 2024-11-25 14:53 | - | |
| 77. Independent Clause Advanced/ | 2024-11-25 14:53 | - | |
| 78. Dependent (Subordinate) Clause Advanced/ | 2024-11-25 14:53 | - | |
| 79. Noun Clause Advanced/ | 2024-11-25 14:54 | - | |
| 80. Adjective (relative) Clause Advanced/ | 2024-11-25 14:54 | - | |
| 81. Adverb Clause Advanced/ | 2024-11-25 14:55 | - | |
| 82. Reported Speech Advanced/ | 2024-11-25 14:55 | - | |
| 83. Common English Grammar Mistakes/ | 2024-11-25 14:55 | - | |
| 84. Fewer VS Less - Then VS Than Common Grammar Mistakes/ | 2024-11-25 14:55 | - | |
| 85. There VS Their VS They're - To VS Too VS Two Common Grammar Mistakes/ | 2024-11-25 14:56 | - | |
| 86. Your VS You're - its VS it's Common Grammar Mistakes/ | 2024-11-25 14:56 | - | |
![[ ]](/icons/unknown.gif) | PaidCoursesForFree.com.url | 2024-10-17 10:16 | 121 | |
|
|---|