![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Time Expressions.pdf | 2024-10-17 03:47 | 1.0M | |
| Compound Nouns.pdf | 2024-10-17 03:46 | 2.0M | |
| Confusing Words.pdf | 2024-10-17 03:46 | 3.5M | |
| Plurals.pdf | 2024-10-17 03:47 | 3.9M | |
| Phrasal Verbs.pdf | 2024-10-17 03:47 | 3.9M | |
| Manner Adverbs.pdf | 2024-10-17 03:47 | 4.4M | |
| Prepositions of Time.pdf | 2024-10-17 03:48 | 4.5M | |
| Irregular Verbs.pdf | 2024-10-17 03:48 | 5.6M | |
| Common Verbs.pdf | 2024-10-17 03:47 | 7.1M | |
| Parts of Speech.pdf | 2024-10-17 03:47 | 8.6M | |
| Lexical Groups.pdf | 2024-10-17 03:47 | 10M | |
| Adjectives (Opposites).pdf | 2024-10-17 03:46 | 12M | |
| Verb Phrases & Collocations.pdf | 2024-10-17 03:47 | 13M | |
| Adjectives (General).pdf | 2024-10-17 03:47 | 13M | |
| Prepositions of Place.pdf | 2024-10-17 03:48 | 55M | |